About (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one
(4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one (PubChem CID 131484948) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one |
| PubChem CID | 131484948 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one |
| SMILES | O=C1NC[C@@H](c2ccc(O)c(O)c2O)N1 |
| InChI | InChI=1S/C9H10N2O4/c12-6-2-1-4(7(13)8(6)14)5-3-10-9(15)11-5/h1-2,5,12-14H,3H2,(H2,10,11,15)/t5-/m0/s1 |
| InChIKey | YUANXUOMBQGIJF-YFKPBYRVSA-N |
| XLogP | 0.16 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one?
The IUPAC name of (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one (CID 131484948) is (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one.
What is the SMILES notation for (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one?
The canonical SMILES for (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one is O=C1NC[C@@H](c2ccc(O)c(O)c2O)N1.
What is the InChIKey of (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one?
The InChIKey is YUANXUOMBQGIJF-YFKPBYRVSA-N. The full InChI is InChI=1S/C9H10N2O4/c12-6-2-1-4(7(13)8(6)14)5-3-10-9(15)11-5/h1-2,5,12-14H,3H2,(H2,10,11,15)/t5-/m0/s1.
What are the key properties of (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one?
(4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one has a molecular weight of 210.19 g/mol, XLogP of 0.16, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(2,3,4-trihydroxyphenyl)imidazolidin-2-one is sourced from PubChem (CID 131484948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).