About 4-methoxy-6-methylhepta-1,2-diene
4-methoxy-6-methylhepta-1,2-diene (PubChem CID 13148608) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-methoxy-6-methylhepta-1,2-diene.
Molecular Properties
| Compound Name | 4-methoxy-6-methylhepta-1,2-diene |
| PubChem CID | 13148608 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 4-methoxy-6-methylhepta-1,2-diene |
| SMILES | C=C=CC(CC(C)C)OC |
| InChI | InChI=1S/C9H16O/c1-5-6-9(10-4)7-8(2)3/h6,8-9H,1,7H2,2-4H3 |
| InChIKey | XHKCHWDKEJBIAJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methoxy-6-methylhepta-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-methylhepta-1,2-diene?
The IUPAC name of 4-methoxy-6-methylhepta-1,2-diene (CID 13148608) is 4-methoxy-6-methylhepta-1,2-diene.
What is the SMILES notation for 4-methoxy-6-methylhepta-1,2-diene?
The canonical SMILES for 4-methoxy-6-methylhepta-1,2-diene is C=C=CC(CC(C)C)OC.
What is the InChIKey of 4-methoxy-6-methylhepta-1,2-diene?
The InChIKey is XHKCHWDKEJBIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-5-6-9(10-4)7-8(2)3/h6,8-9H,1,7H2,2-4H3.
What are the key properties of 4-methoxy-6-methylhepta-1,2-diene?
4-methoxy-6-methylhepta-1,2-diene has a molecular weight of 140.23 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-methylhepta-1,2-diene is sourced from PubChem (CID 13148608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).