About (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine
(1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine (PubChem CID 131486817) has the molecular formula C10H11Cl3N2
and a molecular weight of 265.57 g/mol. Its IUPAC name is (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine.
Molecular Properties
| Compound Name | (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine |
| PubChem CID | 131486817 |
| Molecular Formula | C10H11Cl3N2 |
| Molecular Weight | 265.57 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine |
| SMILES | N[C@@H](CC1CC1)c1c(Cl)cnc(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl3N2/c11-6-4-15-10(13)9(12)8(6)7(14)3-5-1-2-5/h4-5,7H,1-3,14H2/t7-/m0/s1 |
| InChIKey | NQWZVRZDJWDMLN-ZETCQYMHSA-N |
| XLogP | 3.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine?
The IUPAC name of (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine (CID 131486817) is (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine.
What is the SMILES notation for (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine?
The canonical SMILES for (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine is N[C@@H](CC1CC1)c1c(Cl)cnc(Cl)c1Cl.
What is the InChIKey of (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine?
The InChIKey is NQWZVRZDJWDMLN-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H11Cl3N2/c11-6-4-15-10(13)9(12)8(6)7(14)3-5-1-2-5/h4-5,7H,1-3,14H2/t7-/m0/s1.
What are the key properties of (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine?
(1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine has a molecular weight of 265.57 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-cyclopropyl-1-(2,3,5-trichloro-4-pyridinyl)ethanamine is sourced from PubChem (CID 131486817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).