About 2,4,6,7-tetramethylquinoline
2,4,6,7-tetramethylquinoline (PubChem CID 13148811) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2,4,6,7-tetramethylquinoline.
Molecular Properties
| Compound Name | 2,4,6,7-tetramethylquinoline |
| PubChem CID | 13148811 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2,4,6,7-tetramethylquinoline |
| SMILES | Cc1cc(C)c2cc(C)c(C)cc2n1 |
| InChI | InChI=1S/C13H15N/c1-8-6-12-10(3)5-11(4)14-13(12)7-9(8)2/h5-7H,1-4H3 |
| InChIKey | ATWTWGXHWNHOCR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,6,7-tetramethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6,7-tetramethylquinoline?
The IUPAC name of 2,4,6,7-tetramethylquinoline (CID 13148811) is 2,4,6,7-tetramethylquinoline.
What is the SMILES notation for 2,4,6,7-tetramethylquinoline?
The canonical SMILES for 2,4,6,7-tetramethylquinoline is Cc1cc(C)c2cc(C)c(C)cc2n1.
What is the InChIKey of 2,4,6,7-tetramethylquinoline?
The InChIKey is ATWTWGXHWNHOCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-8-6-12-10(3)5-11(4)14-13(12)7-9(8)2/h5-7H,1-4H3.
What are the key properties of 2,4,6,7-tetramethylquinoline?
2,4,6,7-tetramethylquinoline has a molecular weight of 185.27 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6,7-tetramethylquinoline is sourced from PubChem (CID 13148811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).