About (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol
(2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol (PubChem CID 13149086) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol.
Molecular Properties
| Compound Name | (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol |
| PubChem CID | 13149086 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol |
| SMILES | COCOC[C@H]1OC=C[C@@H]1O |
| InChI | InChI=1S/C7H12O4/c1-9-5-10-4-7-6(8)2-3-11-7/h2-3,6-8H,4-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | WQCRGGUKEFTOEW-NKWVEPMBSA-N |
| XLogP | -0.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol?
The IUPAC name of (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol (CID 13149086) is (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol.
What is the SMILES notation for (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol?
The canonical SMILES for (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol is COCOC[C@H]1OC=C[C@@H]1O.
What is the InChIKey of (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol?
The InChIKey is WQCRGGUKEFTOEW-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H12O4/c1-9-5-10-4-7-6(8)2-3-11-7/h2-3,6-8H,4-5H2,1H3/t6-,7+/m0/s1.
What are the key properties of (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol?
(2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol has a molecular weight of 160.17 g/mol, XLogP of -0.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-(methoxymethoxymethyl)-2,3-dihydrofuran-3-ol is sourced from PubChem (CID 13149086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).