C13H18N2O5 — CID 13149088
5-[(2S,5S)-5-(methoxymethoxymethyl)-2,5-dihydrofuran-2-yl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 13149088) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-[(2S,5S)-5-(methoxymethoxymethyl)-2,5-dihydrofuran-2-yl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[(2S,5S)-5-(methoxymethoxymethyl)-2,5-dihydrofuran-2-yl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 13149088 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 5-[(2S,5S)-5-(methoxymethoxymethyl)-2,5-dihydrofuran-2-yl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COCOC[C@@H]1C=C[C@@H](c2cn(C)c(=O)n(C)c2=O)O1 |
| InChI | InChI=1S/C13H18N2O5/c1-14-6-10(12(16)15(2)13(14)17)11-5-4-9(20-11)7-19-8-18-3/h4-6,9,11H,7-8H2,1-3H3/t9-,11-/m0/s1 |
| InChIKey | XGNGZPPYZQKIQE-ONGXEEELSA-N |
| XLogP | -0.30 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|