About 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine
3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine (PubChem CID 131492152) has the molecular formula C8H4ClF6N
and a molecular weight of 263.57 g/mol. Its IUPAC name is 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine |
| PubChem CID | 131492152 |
| Molecular Formula | C8H4ClF6N |
| Molecular Weight | 263.57 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(CCl)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H4ClF6N/c9-3-4-1-2-5(7(10,11)12)16-6(4)8(13,14)15/h1-2H,3H2 |
| InChIKey | ZOPTUFILYAZWAB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine?
The IUPAC name of 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine (CID 131492152) is 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine.
What is the SMILES notation for 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine?
The canonical SMILES for 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine is FC(F)(F)c1ccc(CCl)c(C(F)(F)F)n1.
What is the InChIKey of 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine?
The InChIKey is ZOPTUFILYAZWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClF6N/c9-3-4-1-2-5(7(10,11)12)16-6(4)8(13,14)15/h1-2H,3H2.
What are the key properties of 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine?
3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine has a molecular weight of 263.57 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2,6-bis(trifluoromethyl)pyridine is sourced from PubChem (CID 131492152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).