About 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one
7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one (PubChem CID 13149276) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one.
Analyze 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one?
The IUPAC name of 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one (CID 13149276) is 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one.
What is the SMILES notation for 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one?
The canonical SMILES for 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one is O=c1ccnc2n1CCCCC2.
What is the InChIKey of 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one?
The InChIKey is UUQLOAPMNRJSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c12-9-5-6-10-8-4-2-1-3-7-11(8)9/h5-6H,1-4,7H2.
What are the key properties of 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one?
7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one has a molecular weight of 164.21 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-4-one is sourced from PubChem (CID 13149276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).