C7H6F3NO — CID 131499215
2,2-difluoro-1-(3-fluoro-2-pyridinyl)ethanol (PubChem CID 131499215) has the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. Its IUPAC name is 2,2-difluoro-1-(3-fluoro-2-pyridinyl)ethanol.
| Compound Name | 2,2-difluoro-1-(3-fluoro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 131499215 |
| Molecular Formula | C7H6F3NO |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2,2-difluoro-1-(3-fluoro-2-pyridinyl)ethanol |
| SMILES | OC(c1ncccc1F)C(F)F |
| InChI | InChI=1S/C7H6F3NO/c8-4-2-1-3-11-5(4)6(12)7(9)10/h1-3,6-7,12H |
| InChIKey | QCZIKTIODJOMEU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |