About 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol
2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol (PubChem CID 131502833) has the molecular formula C6H3Cl2N3O
and a molecular weight of 204.02 g/mol. Its IUPAC name is 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol.
Molecular Properties
| Compound Name | 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol |
| PubChem CID | 131502833 |
| Molecular Formula | C6H3Cl2N3O |
| Molecular Weight | 204.02 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol |
| SMILES | Oc1c[nH]c2nc(Cl)nc(Cl)c12 |
| InChI | InChI=1S/C6H3Cl2N3O/c7-4-3-2(12)1-9-5(3)11-6(8)10-4/h1,12H,(H,9,10,11) |
| InChIKey | CJAKMNNMZAZOGO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.02 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol?
The IUPAC name of 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol (CID 131502833) is 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol.
What is the SMILES notation for 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol?
The canonical SMILES for 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol is Oc1c[nH]c2nc(Cl)nc(Cl)c12.
What is the InChIKey of 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol?
The InChIKey is CJAKMNNMZAZOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2N3O/c7-4-3-2(12)1-9-5(3)11-6(8)10-4/h1,12H,(H,9,10,11).
What are the key properties of 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol?
2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol has a molecular weight of 204.02 g/mol, XLogP of 1.97, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-ol is sourced from PubChem (CID 131502833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).