C10H13NO3S — CID 131503825
6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-sulfonamide (PubChem CID 131503825) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 131503825 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-sulfonamide |
| SMILES | NS(=O)(=O)C1CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C10H13NO3S/c11-15(13,14)10-4-2-7-5-9(12)3-1-8(7)6-10/h1,3,5,10,12H,2,4,6H2,(H2,11,13,14) |
| InChIKey | CNTHLDRMHZJWQG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |