About 3-pyridin-2-yloxyaniline
3-pyridin-2-yloxyaniline (PubChem CID 13150573) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-pyridin-2-yloxyaniline.
Molecular Properties
| Compound Name | 3-pyridin-2-yloxyaniline |
| PubChem CID | 13150573 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-pyridin-2-yloxyaniline |
| SMILES | Nc1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C11H10N2O/c12-9-4-3-5-10(8-9)14-11-6-1-2-7-13-11/h1-8H,12H2 |
| InChIKey | CLQMOPKXIBQKKG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-2-yloxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-yloxyaniline?
The IUPAC name of 3-pyridin-2-yloxyaniline (CID 13150573) is 3-pyridin-2-yloxyaniline.
What is the SMILES notation for 3-pyridin-2-yloxyaniline?
The canonical SMILES for 3-pyridin-2-yloxyaniline is Nc1cccc(Oc2ccccn2)c1.
What is the InChIKey of 3-pyridin-2-yloxyaniline?
The InChIKey is CLQMOPKXIBQKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c12-9-4-3-5-10(8-9)14-11-6-1-2-7-13-11/h1-8H,12H2.
What are the key properties of 3-pyridin-2-yloxyaniline?
3-pyridin-2-yloxyaniline has a molecular weight of 186.21 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-yloxyaniline is sourced from PubChem (CID 13150573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).