C13H10ClN — CID 131507927
(1R,8S,9S,12S)-8-chlorotricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-12-carbonitrile (PubChem CID 131507927) has the molecular formula C13H10ClN and a molecular weight of 215.68 g/mol. Its IUPAC name is (1R,8S,9S,12S)-8-chlorotricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-12-carbonitrile.
| Compound Name | (1R,8S,9S,12S)-8-chlorotricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-12-carbonitrile |
|---|---|
| PubChem CID | 131507927 |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | (1R,8S,9S,12S)-8-chlorotricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-12-carbonitrile |
| SMILES | N#C[C@@H]1[C@@H]2C=C[C@H]1c1ccccc1[C@H]2Cl |
| InChI | InChI=1S/C13H10ClN/c14-13-10-4-2-1-3-8(10)9-5-6-11(13)12(9)7-15/h1-6,9,11-13H/t9-,11-,12-,13+/m0/s1 |
| InChIKey | ISCVLTPNIFSFPS-XYJRDEOASA-N |
| XLogP | 3.39 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|