About (Z)-1,2-bis(propylsulfanyl)prop-1-ene
(Z)-1,2-bis(propylsulfanyl)prop-1-ene (PubChem CID 13151365) has the molecular formula C9H18S2
and a molecular weight of 190.38 g/mol. Its IUPAC name is (Z)-1,2-bis(propylsulfanyl)prop-1-ene.
Molecular Properties
| Compound Name | (Z)-1,2-bis(propylsulfanyl)prop-1-ene |
| PubChem CID | 13151365 |
| Molecular Formula | C9H18S2 |
| Molecular Weight | 190.38 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (Z)-1,2-bis(propylsulfanyl)prop-1-ene |
| SMILES | CCCS/C=C(/C)SCCC |
| InChI | InChI=1S/C9H18S2/c1-4-6-10-8-9(3)11-7-5-2/h8H,4-7H2,1-3H3/b9-8- |
| InChIKey | VECKYQMPBQDKPY-HJWRWDBZSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,2-bis(propylsulfanyl)prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,2-bis(propylsulfanyl)prop-1-ene?
The IUPAC name of (Z)-1,2-bis(propylsulfanyl)prop-1-ene (CID 13151365) is (Z)-1,2-bis(propylsulfanyl)prop-1-ene.
What is the SMILES notation for (Z)-1,2-bis(propylsulfanyl)prop-1-ene?
The canonical SMILES for (Z)-1,2-bis(propylsulfanyl)prop-1-ene is CCCS/C=C(/C)SCCC.
What is the InChIKey of (Z)-1,2-bis(propylsulfanyl)prop-1-ene?
The InChIKey is VECKYQMPBQDKPY-HJWRWDBZSA-N. The full InChI is InChI=1S/C9H18S2/c1-4-6-10-8-9(3)11-7-5-2/h8H,4-7H2,1-3H3/b9-8-.
What are the key properties of (Z)-1,2-bis(propylsulfanyl)prop-1-ene?
(Z)-1,2-bis(propylsulfanyl)prop-1-ene has a molecular weight of 190.38 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,2-bis(propylsulfanyl)prop-1-ene is sourced from PubChem (CID 13151365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).