About 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile
3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile (PubChem CID 13151868) has the molecular formula C17H13NOS
and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile.
Molecular Properties
| Compound Name | 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile |
| PubChem CID | 13151868 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile |
| SMILES | CC(=O)c1ccc2c(c1)CCc1ccc(C#N)cc1S2 |
| InChI | InChI=1S/C17H13NOS/c1-11(19)14-6-7-16-15(9-14)5-4-13-3-2-12(10-18)8-17(13)20-16/h2-3,6-9H,4-5H2,1H3 |
| InChIKey | PLRHXRSKQZEJPJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile?
The IUPAC name of 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile (CID 13151868) is 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile.
What is the SMILES notation for 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile?
The canonical SMILES for 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile is CC(=O)c1ccc2c(c1)CCc1ccc(C#N)cc1S2.
What is the InChIKey of 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile?
The InChIKey is PLRHXRSKQZEJPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NOS/c1-11(19)14-6-7-16-15(9-14)5-4-13-3-2-12(10-18)8-17(13)20-16/h2-3,6-9H,4-5H2,1H3.
What are the key properties of 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile?
3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile has a molecular weight of 279.36 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-5,6-dihydrobenzo[b][1]benzothiepine-9-carbonitrile is sourced from PubChem (CID 13151868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).