C22H17N3O15S5 — CID 13152136
8-[[3-[(3-nitrophenyl)sulfonylamino]phenyl]sulfonylamino]naphthalene-1,3,6-trisulfonic acid (PubChem CID 13152136) has the molecular formula C22H17N3O15S5 and a molecular weight of 723.72 g/mol. Its IUPAC name is 8-[[3-[(3-nitrophenyl)sulfonylamino]phenyl]sulfonylamino]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 8-[[3-[(3-nitrophenyl)sulfonylamino]phenyl]sulfonylamino]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 13152136 |
| Molecular Formula | C22H17N3O15S5 |
| Molecular Weight | 723.72 g/mol |
| Exact Mass | 722.93 |
| IUPAC Name | 8-[[3-[(3-nitrophenyl)sulfonylamino]phenyl]sulfonylamino]naphthalene-1,3,6-trisulfonic acid |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2cccc(S(=O)(=O)Nc3cc(S(=O)(=O)O)cc4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)c2)c1 |
| InChI | InChI=1S/C22H17N3O15S5/c26-25(27)15-4-2-6-17(10-15)41(28,29)23-14-3-1-5-16(9-14)42(30,31)24-20-11-18(43(32,33)34)7-13-8-19(44(35,36)37)12-21(22(13)20)45(38,39)40/h1-12,23-24H,(H,32,33,34)(H,35,36,37)(H,38,39,40) |
| InChIKey | WUCXUDPEDGPNAF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 298.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|