About methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate
methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 131527371) has the molecular formula C10H10ClNO3
and a molecular weight of 227.65 g/mol. Its IUPAC name is methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate |
| PubChem CID | 131527371 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)C1Cc2c(ccc(N)c2Cl)O1 |
| InChI | InChI=1S/C10H10ClNO3/c1-14-10(13)8-4-5-7(15-8)3-2-6(12)9(5)11/h2-3,8H,4,12H2,1H3 |
| InChIKey | FDJNPOVYUUFOSM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate?
The IUPAC name of methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate (CID 131527371) is methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate.
What is the SMILES notation for methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate?
The canonical SMILES for methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate is COC(=O)C1Cc2c(ccc(N)c2Cl)O1.
What is the InChIKey of methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate?
The InChIKey is FDJNPOVYUUFOSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO3/c1-14-10(13)8-4-5-7(15-8)3-2-6(12)9(5)11/h2-3,8H,4,12H2,1H3.
What are the key properties of methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate?
methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate has a molecular weight of 227.65 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-4-chloro-2,3-dihydro-1-benzofuran-2-carboxylate is sourced from PubChem (CID 131527371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).