About 1-hexa-1,5-dien-3-ylpiperidine
1-hexa-1,5-dien-3-ylpiperidine (PubChem CID 13153014) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-hexa-1,5-dien-3-ylpiperidine.
Molecular Properties
| Compound Name | 1-hexa-1,5-dien-3-ylpiperidine |
| PubChem CID | 13153014 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-hexa-1,5-dien-3-ylpiperidine |
| SMILES | C=CCC(C=C)N1CCCCC1 |
| InChI | InChI=1S/C11H19N/c1-3-8-11(4-2)12-9-6-5-7-10-12/h3-4,11H,1-2,5-10H2 |
| InChIKey | GWUXPBPHQQJOPM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hexa-1,5-dien-3-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexa-1,5-dien-3-ylpiperidine?
The IUPAC name of 1-hexa-1,5-dien-3-ylpiperidine (CID 13153014) is 1-hexa-1,5-dien-3-ylpiperidine.
What is the SMILES notation for 1-hexa-1,5-dien-3-ylpiperidine?
The canonical SMILES for 1-hexa-1,5-dien-3-ylpiperidine is C=CCC(C=C)N1CCCCC1.
What is the InChIKey of 1-hexa-1,5-dien-3-ylpiperidine?
The InChIKey is GWUXPBPHQQJOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-3-8-11(4-2)12-9-6-5-7-10-12/h3-4,11H,1-2,5-10H2.
What are the key properties of 1-hexa-1,5-dien-3-ylpiperidine?
1-hexa-1,5-dien-3-ylpiperidine has a molecular weight of 165.28 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexa-1,5-dien-3-ylpiperidine is sourced from PubChem (CID 13153014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).