C16H22O3 — CID 13153059
(2R,3S)-2-(4-cyclohexylphenyl)-3-hydroxybutanoic acid (PubChem CID 13153059) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2R,3S)-2-(4-cyclohexylphenyl)-3-hydroxybutanoic acid.
| Compound Name | (2R,3S)-2-(4-cyclohexylphenyl)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 13153059 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (2R,3S)-2-(4-cyclohexylphenyl)-3-hydroxybutanoic acid |
| SMILES | C[C@H](O)[C@H](C(=O)O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22O3/c1-11(17)15(16(18)19)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h7-12,15,17H,2-6H2,1H3,(H,18,19)/t11-,15-/m0/s1 |
| InChIKey | LNDKEFFVJSOTLX-NHYWBVRUSA-N |
| XLogP | 3.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |