About N-methyl-3,5-dinitro-1H-pyrazol-4-amine
N-methyl-3,5-dinitro-1H-pyrazol-4-amine (PubChem CID 131531466) has the molecular formula C4H5N5O4
and a molecular weight of 187.11 g/mol. Its IUPAC name is N-methyl-3,5-dinitro-1H-pyrazol-4-amine.
Molecular Properties
| Compound Name | N-methyl-3,5-dinitro-1H-pyrazol-4-amine |
| PubChem CID | 131531466 |
| Molecular Formula | C4H5N5O4 |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | N-methyl-3,5-dinitro-1H-pyrazol-4-amine |
| SMILES | CNc1c([N+](=O)[O-])n[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C4H5N5O4/c1-5-2-3(8(10)11)6-7-4(2)9(12)13/h5H,1H3,(H,6,7) |
| InChIKey | WAFDUIITJAWYDC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3,5-dinitro-1H-pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3,5-dinitro-1H-pyrazol-4-amine?
The IUPAC name of N-methyl-3,5-dinitro-1H-pyrazol-4-amine (CID 131531466) is N-methyl-3,5-dinitro-1H-pyrazol-4-amine.
What is the SMILES notation for N-methyl-3,5-dinitro-1H-pyrazol-4-amine?
The canonical SMILES for N-methyl-3,5-dinitro-1H-pyrazol-4-amine is CNc1c([N+](=O)[O-])n[nH]c1[N+](=O)[O-].
What is the InChIKey of N-methyl-3,5-dinitro-1H-pyrazol-4-amine?
The InChIKey is WAFDUIITJAWYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N5O4/c1-5-2-3(8(10)11)6-7-4(2)9(12)13/h5H,1H3,(H,6,7).
What are the key properties of N-methyl-3,5-dinitro-1H-pyrazol-4-amine?
N-methyl-3,5-dinitro-1H-pyrazol-4-amine has a molecular weight of 187.11 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3,5-dinitro-1H-pyrazol-4-amine is sourced from PubChem (CID 131531466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).