C14H18N2 — CID 13153343
1-methyl-3-phenyl-3a,4,5,6,7,7a-hexahydroindazole (PubChem CID 13153343) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-methyl-3-phenyl-3a,4,5,6,7,7a-hexahydroindazole.
| Compound Name | 1-methyl-3-phenyl-3a,4,5,6,7,7a-hexahydroindazole |
|---|---|
| PubChem CID | 13153343 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-methyl-3-phenyl-3a,4,5,6,7,7a-hexahydroindazole |
| SMILES | CN1N=C(c2ccccc2)C2CCCCC21 |
| InChI | InChI=1S/C14H18N2/c1-16-13-10-6-5-9-12(13)14(15-16)11-7-3-2-4-8-11/h2-4,7-8,12-13H,5-6,9-10H2,1H3 |
| InChIKey | VDONJQJLQICTHE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |