About methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate
methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate (PubChem CID 13153346) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate |
| PubChem CID | 13153346 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate |
| SMILES | COC(=O)C1C(C)C(c2ccccc2)=NN1C |
| InChI | InChI=1S/C13H16N2O2/c1-9-11(10-7-5-4-6-8-10)14-15(2)12(9)13(16)17-3/h4-9,12H,1-3H3 |
| InChIKey | KPJWYIXFMKDIOS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate?
The IUPAC name of methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate (CID 13153346) is methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate.
What is the SMILES notation for methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate?
The canonical SMILES for methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate is COC(=O)C1C(C)C(c2ccccc2)=NN1C.
What is the InChIKey of methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate?
The InChIKey is KPJWYIXFMKDIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2/c1-9-11(10-7-5-4-6-8-10)14-15(2)12(9)13(16)17-3/h4-9,12H,1-3H3.
What are the key properties of methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate?
methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate has a molecular weight of 232.28 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethyl-5-phenyl-3,4-dihydropyrazole-3-carboxylate is sourced from PubChem (CID 13153346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).