About methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate
methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate (PubChem CID 13153360) has the molecular formula C11H11N3O2
and a molecular weight of 217.23 g/mol. Its IUPAC name is methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 13153360 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccccc2)nn1C |
| InChI | InChI=1S/C11H11N3O2/c1-14-10(11(15)16-2)12-9(13-14)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | GIDZYLNBUBPGLQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate (CID 13153360) is methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate is COC(=O)c1nc(-c2ccccc2)nn1C.
What is the InChIKey of methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate?
The InChIKey is GIDZYLNBUBPGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2/c1-14-10(11(15)16-2)12-9(13-14)8-6-4-3-5-7-8/h3-7H,1-2H3.
What are the key properties of methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate?
methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate has a molecular weight of 217.23 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 13153360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).