About 1,2-diphenylphosphindole
1,2-diphenylphosphindole (PubChem CID 13153790) has the molecular formula C20H15P
and a molecular weight of 286.31 g/mol. Its IUPAC name is 1,2-diphenylphosphindole.
Molecular Properties
| Compound Name | 1,2-diphenylphosphindole |
| PubChem CID | 13153790 |
| Molecular Formula | C20H15P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1,2-diphenylphosphindole |
| SMILES | c1ccc(-c2cc3ccccc3p2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15P/c1-3-9-16(10-4-1)20-15-17-11-7-8-14-19(17)21(20)18-12-5-2-6-13-18/h1-15H |
| InChIKey | MFZGDNOXZRRJEX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-diphenylphosphindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylphosphindole?
The IUPAC name of 1,2-diphenylphosphindole (CID 13153790) is 1,2-diphenylphosphindole.
What is the SMILES notation for 1,2-diphenylphosphindole?
The canonical SMILES for 1,2-diphenylphosphindole is c1ccc(-c2cc3ccccc3p2-c2ccccc2)cc1.
What is the InChIKey of 1,2-diphenylphosphindole?
The InChIKey is MFZGDNOXZRRJEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15P/c1-3-9-16(10-4-1)20-15-17-11-7-8-14-19(17)21(20)18-12-5-2-6-13-18/h1-15H.
What are the key properties of 1,2-diphenylphosphindole?
1,2-diphenylphosphindole has a molecular weight of 286.31 g/mol, XLogP of 6.48, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylphosphindole is sourced from PubChem (CID 13153790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).