About [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol
[(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol (PubChem CID 131538668) has the molecular formula C10H11F2NO
and a molecular weight of 199.20 g/mol. Its IUPAC name is [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol |
| PubChem CID | 131538668 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol |
| SMILES | N[C@@]1(CO)CCc2c1ccc(F)c2F |
| InChI | InChI=1S/C10H11F2NO/c11-8-2-1-7-6(9(8)12)3-4-10(7,13)5-14/h1-2,14H,3-5,13H2/t10-/m1/s1 |
| InChIKey | KKYXEFGKGYHJRK-SNVBAGLBSA-N |
| XLogP | 1.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol?
The IUPAC name of [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol (CID 131538668) is [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol.
What is the SMILES notation for [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol?
The canonical SMILES for [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol is N[C@@]1(CO)CCc2c1ccc(F)c2F.
What is the InChIKey of [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol?
The InChIKey is KKYXEFGKGYHJRK-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H11F2NO/c11-8-2-1-7-6(9(8)12)3-4-10(7,13)5-14/h1-2,14H,3-5,13H2/t10-/m1/s1.
What are the key properties of [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol?
[(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol has a molecular weight of 199.20 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-amino-4,5-difluoro-2,3-dihydroinden-1-yl]methanol is sourced from PubChem (CID 131538668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).