About oxetan-3-yl 4-methylbenzenesulfonate
oxetan-3-yl 4-methylbenzenesulfonate (PubChem CID 13153907) has the molecular formula C10H12O4S
and a molecular weight of 228.27 g/mol. Its IUPAC name is oxetan-3-yl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | oxetan-3-yl 4-methylbenzenesulfonate |
| PubChem CID | 13153907 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | oxetan-3-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2COC2)cc1 |
| InChI | InChI=1S/C10H12O4S/c1-8-2-4-10(5-3-8)15(11,12)14-9-6-13-7-9/h2-5,9H,6-7H2,1H3 |
| InChIKey | UMFWNFVHKAJOSE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze oxetan-3-yl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-3-yl 4-methylbenzenesulfonate?
The IUPAC name of oxetan-3-yl 4-methylbenzenesulfonate (CID 13153907) is oxetan-3-yl 4-methylbenzenesulfonate.
What is the SMILES notation for oxetan-3-yl 4-methylbenzenesulfonate?
The canonical SMILES for oxetan-3-yl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC2COC2)cc1.
What is the InChIKey of oxetan-3-yl 4-methylbenzenesulfonate?
The InChIKey is UMFWNFVHKAJOSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4S/c1-8-2-4-10(5-3-8)15(11,12)14-9-6-13-7-9/h2-5,9H,6-7H2,1H3.
What are the key properties of oxetan-3-yl 4-methylbenzenesulfonate?
oxetan-3-yl 4-methylbenzenesulfonate has a molecular weight of 228.27 g/mol, XLogP of 1.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-3-yl 4-methylbenzenesulfonate is sourced from PubChem (CID 13153907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).