C21H25NO4 — CID 13154144
benzyl 1-[(3,4-dimethoxyphenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 13154144) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is benzyl 1-[(3,4-dimethoxyphenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-[(3,4-dimethoxyphenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 13154144 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | benzyl 1-[(3,4-dimethoxyphenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COc1ccc(CN2CCCC2C(=O)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C21H25NO4/c1-24-19-11-10-17(13-20(19)25-2)14-22-12-6-9-18(22)21(23)26-15-16-7-4-3-5-8-16/h3-5,7-8,10-11,13,18H,6,9,12,14-15H2,1-2H3 |
| InChIKey | UJVIKZCMUYQTQS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |