C10H13ClN2O — CID 13154248
N-(6-chloro-2-pyridinyl)-2,2-dimethylpropanamide (PubChem CID 13154248) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-2,2-dimethylpropanamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 13154248 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C10H13ClN2O/c1-10(2,3)9(14)13-8-6-4-5-7(11)12-8/h4-6H,1-3H3,(H,12,13,14) |
| InChIKey | YPWKLBCTOUEZKE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|