1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid

C6H8N2O3 — CID 13154356

IUPAC1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid
SMILESNC(=O)N1CCC=C1C(=O)O
InChIInChI=1S/C6H8N2O3/c7-6(11)8-3-1-2-4(8)5(9)10/h2H,1,3H2,(H2,7,11)(H,9,10)
InChIKeyBENSRYRKCJTVRK-UHFFFAOYSA-N
MW156.14 g/mol
LogP-0.26
Rot. Bonds1

About 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid

1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid (PubChem CID 13154356) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid.

Molecular Properties

Compound Name1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid
PubChem CID13154356
Molecular FormulaC6H8N2O3
Molecular Weight156.14 g/mol
Exact Mass156.05
IUPAC Name1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid
SMILESNC(=O)N1CCC=C1C(=O)O
InChIInChI=1S/C6H8N2O3/c7-6(11)8-3-1-2-4(8)5(9)10/h2H,1,3H2,(H2,7,11)(H,9,10)
InChIKeyBENSRYRKCJTVRK-UHFFFAOYSA-N
XLogP-0.26
TPSA83.63 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 5-0.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid?
The IUPAC name of 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid (CID 13154356) is 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid.
What is the SMILES notation for 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid?
The canonical SMILES for 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid is NC(=O)N1CCC=C1C(=O)O.
What is the InChIKey of 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid?
The InChIKey is BENSRYRKCJTVRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c7-6(11)8-3-1-2-4(8)5(9)10/h2H,1,3H2,(H2,7,11)(H,9,10).
What are the key properties of 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid?
1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of -0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid is sourced from PubChem (CID 13154356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).