About 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid
1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid (PubChem CID 13154356) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid |
| PubChem CID | 13154356 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid |
| SMILES | NC(=O)N1CCC=C1C(=O)O |
| InChI | InChI=1S/C6H8N2O3/c7-6(11)8-3-1-2-4(8)5(9)10/h2H,1,3H2,(H2,7,11)(H,9,10) |
| InChIKey | BENSRYRKCJTVRK-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid?
The IUPAC name of 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid (CID 13154356) is 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid.
What is the SMILES notation for 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid?
The canonical SMILES for 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid is NC(=O)N1CCC=C1C(=O)O.
What is the InChIKey of 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid?
The InChIKey is BENSRYRKCJTVRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c7-6(11)8-3-1-2-4(8)5(9)10/h2H,1,3H2,(H2,7,11)(H,9,10).
What are the key properties of 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid?
1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of -0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamoyl-2,3-dihydropyrrole-5-carboxylic acid is sourced from PubChem (CID 13154356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).