About 2-amino-1,4-dihydropyrimidine-6-carboxylic acid
2-amino-1,4-dihydropyrimidine-6-carboxylic acid (PubChem CID 13154369) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-amino-1,4-dihydropyrimidine-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-1,4-dihydropyrimidine-6-carboxylic acid |
| PubChem CID | 13154369 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 2-amino-1,4-dihydropyrimidine-6-carboxylic acid |
| SMILES | NC1=NCC=C(C(=O)O)N1 |
| InChI | InChI=1S/C5H7N3O2/c6-5-7-2-1-3(8-5)4(9)10/h1H,2H2,(H,9,10)(H3,6,7,8) |
| InChIKey | JGOZCSIBOJZBAN-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1,4-dihydropyrimidine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,4-dihydropyrimidine-6-carboxylic acid?
The IUPAC name of 2-amino-1,4-dihydropyrimidine-6-carboxylic acid (CID 13154369) is 2-amino-1,4-dihydropyrimidine-6-carboxylic acid.
What is the SMILES notation for 2-amino-1,4-dihydropyrimidine-6-carboxylic acid?
The canonical SMILES for 2-amino-1,4-dihydropyrimidine-6-carboxylic acid is NC1=NCC=C(C(=O)O)N1.
What is the InChIKey of 2-amino-1,4-dihydropyrimidine-6-carboxylic acid?
The InChIKey is JGOZCSIBOJZBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c6-5-7-2-1-3(8-5)4(9)10/h1H,2H2,(H,9,10)(H3,6,7,8).
What are the key properties of 2-amino-1,4-dihydropyrimidine-6-carboxylic acid?
2-amino-1,4-dihydropyrimidine-6-carboxylic acid has a molecular weight of 141.13 g/mol, XLogP of -1.13, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,4-dihydropyrimidine-6-carboxylic acid is sourced from PubChem (CID 13154369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).