About (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine
(E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine (PubChem CID 131544346) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine |
| PubChem CID | 131544346 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine |
| SMILES | C/C=C/C(NC)c1ccns1 |
| InChI | InChI=1S/C8H12N2S/c1-3-4-7(9-2)8-5-6-10-11-8/h3-7,9H,1-2H3/b4-3+ |
| InChIKey | PAUTWNSBOFJKDE-ONEGZZNKSA-N |
| XLogP | 1.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine?
The IUPAC name of (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine (CID 131544346) is (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine.
What is the SMILES notation for (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine?
The canonical SMILES for (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine is C/C=C/C(NC)c1ccns1.
What is the InChIKey of (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine?
The InChIKey is PAUTWNSBOFJKDE-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H12N2S/c1-3-4-7(9-2)8-5-6-10-11-8/h3-7,9H,1-2H3/b4-3+.
What are the key properties of (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine?
(E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine has a molecular weight of 168.26 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methyl-1-(1,2-thiazol-5-yl)but-2-en-1-amine is sourced from PubChem (CID 131544346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).