About dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene
dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 13155452) has the molecular formula C10H12Cl2Pd
and a molecular weight of 309.53 g/mol. Its IUPAC name is dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene.
Molecular Properties
| Compound Name | dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene |
| PubChem CID | 13155452 |
| Molecular Formula | C10H12Cl2Pd |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.Cl[Pd]Cl |
| InChI | InChI=1S/C10H12.2ClH.Pd/c1-2-9-7-4-5-8(6-7)10(9)3-1;;;/h1-2,4-5,7-10H,3,6H2;2*1H;/q;;;+2/p-2 |
| InChIKey | CYRHAHMKYXPNSF-UHFFFAOYSA-L |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene?
The IUPAC name of dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene (CID 13155452) is dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene.
What is the SMILES notation for dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene?
The canonical SMILES for dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene is C1=CC2C3C=CC(C3)C2C1.Cl[Pd]Cl.
What is the InChIKey of dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene?
The InChIKey is CYRHAHMKYXPNSF-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H12.2ClH.Pd/c1-2-9-7-4-5-8(6-7)10(9)3-1;;;/h1-2,4-5,7-10H,3,6H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene?
dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene has a molecular weight of 309.53 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;tricyclo[5.2.1.02,6]deca-3,8-diene is sourced from PubChem (CID 13155452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).