5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid

C9H5FN2O3 — CID 131555755

IUPAC5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccncc2F)on1
InChIInChI=1S/C9H5FN2O3/c10-6-4-11-2-1-5(6)8-3-7(9(13)14)12-15-8/h1-4H,(H,13,14)
InChIKeyZEOFNUYCMAUUQV-UHFFFAOYSA-N
MW208.15 g/mol
LogP1.57
Rot. Bonds2

About 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid

5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 131555755) has the molecular formula C9H5FN2O3 and a molecular weight of 208.15 g/mol. Its IUPAC name is 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid
PubChem CID131555755
Molecular FormulaC9H5FN2O3
Molecular Weight208.15 g/mol
Exact Mass208.03
IUPAC Name5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccncc2F)on1
InChIInChI=1S/C9H5FN2O3/c10-6-4-11-2-1-5(6)8-3-7(9(13)14)12-15-8/h1-4H,(H,13,14)
InChIKeyZEOFNUYCMAUUQV-UHFFFAOYSA-N
XLogP1.57
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.15
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid (CID 131555755) is 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(-c2ccncc2F)on1.
What is the InChIKey of 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is ZEOFNUYCMAUUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5FN2O3/c10-6-4-11-2-1-5(6)8-3-7(9(13)14)12-15-8/h1-4H,(H,13,14).
What are the key properties of 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid?
5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 208.15 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluoro-4-pyridinyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 131555755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).