About 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one
7-methyl-2-propyl-1H-1,8-naphthyridin-4-one (PubChem CID 13155595) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one |
| PubChem CID | 13155595 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one |
| SMILES | CCCc1cc(=O)c2ccc(C)nc2[nH]1 |
| InChI | InChI=1S/C12H14N2O/c1-3-4-9-7-11(15)10-6-5-8(2)13-12(10)14-9/h5-7H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | JAFFZYFREVCDTP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one?
The IUPAC name of 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one (CID 13155595) is 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one is CCCc1cc(=O)c2ccc(C)nc2[nH]1.
What is the InChIKey of 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one?
The InChIKey is JAFFZYFREVCDTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-3-4-9-7-11(15)10-6-5-8(2)13-12(10)14-9/h5-7H,3-4H2,1-2H3,(H,13,14,15).
What are the key properties of 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one?
7-methyl-2-propyl-1H-1,8-naphthyridin-4-one has a molecular weight of 202.26 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-propyl-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 13155595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).