About 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile
3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile (PubChem CID 131558836) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile |
| PubChem CID | 131558836 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile |
| SMILES | N#Cc1c(N)noc1C1CC1 |
| InChI | InChI=1S/C7H7N3O/c8-3-5-6(4-1-2-4)11-10-7(5)9/h4H,1-2H2,(H2,9,10) |
| InChIKey | GSXVJRGQMNKQGQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile?
The IUPAC name of 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile (CID 131558836) is 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile.
What is the SMILES notation for 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile?
The canonical SMILES for 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile is N#Cc1c(N)noc1C1CC1.
What is the InChIKey of 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile?
The InChIKey is GSXVJRGQMNKQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-3-5-6(4-1-2-4)11-10-7(5)9/h4H,1-2H2,(H2,9,10).
What are the key properties of 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile?
3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile has a molecular weight of 149.15 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-cyclopropyl-1,2-oxazole-4-carbonitrile is sourced from PubChem (CID 131558836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).