C18H24N2 — CID 13156004
1-(1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraen-2-yl)-N,N-dimethylmethanamine (PubChem CID 13156004) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraen-2-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraen-2-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 13156004 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-(1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraen-2-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCc2cccc3c4c(n1c23)CCCC4 |
| InChI | InChI=1S/C18H24N2/c1-19(2)12-14-11-10-13-6-5-8-16-15-7-3-4-9-17(15)20(14)18(13)16/h5-6,8,14H,3-4,7,9-12H2,1-2H3 |
| InChIKey | RYXIFIYFXTWNOJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |