About 3-imidazo[2,1-a]isoquinolin-2-ylphenol
3-imidazo[2,1-a]isoquinolin-2-ylphenol (PubChem CID 13156070) has the molecular formula C17H12N2O
and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-imidazo[2,1-a]isoquinolin-2-ylphenol.
Molecular Properties
| Compound Name | 3-imidazo[2,1-a]isoquinolin-2-ylphenol |
| PubChem CID | 13156070 |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-imidazo[2,1-a]isoquinolin-2-ylphenol |
| SMILES | Oc1cccc(-c2cn3ccc4ccccc4c3n2)c1 |
| InChI | InChI=1S/C17H12N2O/c20-14-6-3-5-13(10-14)16-11-19-9-8-12-4-1-2-7-15(12)17(19)18-16/h1-11,20H |
| InChIKey | KAEBHEJLXDMBQP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-imidazo[2,1-a]isoquinolin-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[2,1-a]isoquinolin-2-ylphenol?
The IUPAC name of 3-imidazo[2,1-a]isoquinolin-2-ylphenol (CID 13156070) is 3-imidazo[2,1-a]isoquinolin-2-ylphenol.
What is the SMILES notation for 3-imidazo[2,1-a]isoquinolin-2-ylphenol?
The canonical SMILES for 3-imidazo[2,1-a]isoquinolin-2-ylphenol is Oc1cccc(-c2cn3ccc4ccccc4c3n2)c1.
What is the InChIKey of 3-imidazo[2,1-a]isoquinolin-2-ylphenol?
The InChIKey is KAEBHEJLXDMBQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O/c20-14-6-3-5-13(10-14)16-11-19-9-8-12-4-1-2-7-15(12)17(19)18-16/h1-11,20H.
What are the key properties of 3-imidazo[2,1-a]isoquinolin-2-ylphenol?
3-imidazo[2,1-a]isoquinolin-2-ylphenol has a molecular weight of 260.30 g/mol, XLogP of 3.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[2,1-a]isoquinolin-2-ylphenol is sourced from PubChem (CID 13156070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).