C13H15BFNO4 — CID 131566172
5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-fluoro-3-methyl-1,3-benzoxazol-2-one (PubChem CID 131566172) has the molecular formula C13H15BFNO4 and a molecular weight of 279.08 g/mol. Its IUPAC name is 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-fluoro-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-fluoro-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 131566172 |
| Molecular Formula | C13H15BFNO4 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-fluoro-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2c(F)cc(B3OCC(C)(C)CO3)cc21 |
| InChI | InChI=1S/C13H15BFNO4/c1-13(2)6-18-14(19-7-13)8-4-9(15)11-10(5-8)16(3)12(17)20-11/h4-5H,6-7H2,1-3H3 |
| InChIKey | KMCKZKHTTWZSTC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|