About (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate
(2-bromo-4-methylphenyl) 2,2-dimethylpropanoate (PubChem CID 13156643) has the molecular formula C12H15BrO2
and a molecular weight of 271.15 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate |
| PubChem CID | 13156643 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(OC(=O)C(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C12H15BrO2/c1-8-5-6-10(9(13)7-8)15-11(14)12(2,3)4/h5-7H,1-4H3 |
| InChIKey | JHXCATMUUUWEML-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate?
The IUPAC name of (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate (CID 13156643) is (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate.
What is the SMILES notation for (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate?
The canonical SMILES for (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate is Cc1ccc(OC(=O)C(C)(C)C)c(Br)c1.
What is the InChIKey of (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate?
The InChIKey is JHXCATMUUUWEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO2/c1-8-5-6-10(9(13)7-8)15-11(14)12(2,3)4/h5-7H,1-4H3.
What are the key properties of (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate?
(2-bromo-4-methylphenyl) 2,2-dimethylpropanoate has a molecular weight of 271.15 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-methylphenyl) 2,2-dimethylpropanoate is sourced from PubChem (CID 13156643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).