About N-butyl-N,4-dimethyl-2-trimethylsilylaniline
N-butyl-N,4-dimethyl-2-trimethylsilylaniline (PubChem CID 13156668) has the molecular formula C15H27NSi
and a molecular weight of 249.47 g/mol. Its IUPAC name is N-butyl-N,4-dimethyl-2-trimethylsilylaniline.
Molecular Properties
| Compound Name | N-butyl-N,4-dimethyl-2-trimethylsilylaniline |
| PubChem CID | 13156668 |
| Molecular Formula | C15H27NSi |
| Molecular Weight | 249.47 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | N-butyl-N,4-dimethyl-2-trimethylsilylaniline |
| SMILES | CCCCN(C)c1ccc(C)cc1[Si](C)(C)C |
| InChI | InChI=1S/C15H27NSi/c1-7-8-11-16(3)14-10-9-13(2)12-15(14)17(4,5)6/h9-10,12H,7-8,11H2,1-6H3 |
| InChIKey | YKZVQQIJJRKTGJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N,4-dimethyl-2-trimethylsilylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,4-dimethyl-2-trimethylsilylaniline?
The IUPAC name of N-butyl-N,4-dimethyl-2-trimethylsilylaniline (CID 13156668) is N-butyl-N,4-dimethyl-2-trimethylsilylaniline.
What is the SMILES notation for N-butyl-N,4-dimethyl-2-trimethylsilylaniline?
The canonical SMILES for N-butyl-N,4-dimethyl-2-trimethylsilylaniline is CCCCN(C)c1ccc(C)cc1[Si](C)(C)C.
What is the InChIKey of N-butyl-N,4-dimethyl-2-trimethylsilylaniline?
The InChIKey is YKZVQQIJJRKTGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NSi/c1-7-8-11-16(3)14-10-9-13(2)12-15(14)17(4,5)6/h9-10,12H,7-8,11H2,1-6H3.
What are the key properties of N-butyl-N,4-dimethyl-2-trimethylsilylaniline?
N-butyl-N,4-dimethyl-2-trimethylsilylaniline has a molecular weight of 249.47 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,4-dimethyl-2-trimethylsilylaniline is sourced from PubChem (CID 13156668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).