About 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene
1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene (PubChem CID 13156717) has the molecular formula C14H8Cl4S2
and a molecular weight of 382.16 g/mol. Its IUPAC name is 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene.
Molecular Properties
| Compound Name | 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene |
| PubChem CID | 13156717 |
| Molecular Formula | C14H8Cl4S2 |
| Molecular Weight | 382.16 g/mol |
| Exact Mass | 379.88 |
| IUPAC Name | 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene |
| SMILES | ClC(Cl)=C(Sc1ccc(Cl)cc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H8Cl4S2/c15-9-1-5-11(6-2-9)19-14(13(17)18)20-12-7-3-10(16)4-8-12/h1-8H |
| InChIKey | VOZZQIDIRIAYMM-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.16 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene?
The IUPAC name of 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene (CID 13156717) is 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene.
What is the SMILES notation for 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene?
The canonical SMILES for 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene is ClC(Cl)=C(Sc1ccc(Cl)cc1)Sc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene?
The InChIKey is VOZZQIDIRIAYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl4S2/c15-9-1-5-11(6-2-9)19-14(13(17)18)20-12-7-3-10(16)4-8-12/h1-8H.
What are the key properties of 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene?
1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene has a molecular weight of 382.16 g/mol, XLogP of 7.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethenyl]sulfanylbenzene is sourced from PubChem (CID 13156717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).