About 2,2-dimethyl-1,3-dioxin-4-one
2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 13157035) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-dioxin-4-one |
| PubChem CID | 13157035 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC=CC(=O)O1 |
| InChI | InChI=1S/C6H8O3/c1-6(2)8-4-3-5(7)9-6/h3-4H,1-2H3 |
| InChIKey | UVISGHACCLJRBS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-dioxin-4-one?
The IUPAC name of 2,2-dimethyl-1,3-dioxin-4-one (CID 13157035) is 2,2-dimethyl-1,3-dioxin-4-one.
What is the SMILES notation for 2,2-dimethyl-1,3-dioxin-4-one?
The canonical SMILES for 2,2-dimethyl-1,3-dioxin-4-one is CC1(C)OC=CC(=O)O1.
What is the InChIKey of 2,2-dimethyl-1,3-dioxin-4-one?
The InChIKey is UVISGHACCLJRBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-6(2)8-4-3-5(7)9-6/h3-4H,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-dioxin-4-one?
2,2-dimethyl-1,3-dioxin-4-one has a molecular weight of 128.13 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-dioxin-4-one is sourced from PubChem (CID 13157035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).