About 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol
2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol (PubChem CID 13157038) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol.
Molecular Properties
| Compound Name | 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol |
| PubChem CID | 13157038 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol |
| SMILES | OCC1COc2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C13H12O3/c14-7-10-8-15-12-6-5-9-3-1-2-4-11(9)13(12)16-10/h1-6,10,14H,7-8H2 |
| InChIKey | AXDTTXSWSDJBQS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol?
The IUPAC name of 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol (CID 13157038) is 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol.
What is the SMILES notation for 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol?
The canonical SMILES for 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol is OCC1COc2ccc3ccccc3c2O1.
What is the InChIKey of 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol?
The InChIKey is AXDTTXSWSDJBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c14-7-10-8-15-12-6-5-9-3-1-2-4-11(9)13(12)16-10/h1-6,10,14H,7-8H2.
What are the key properties of 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol?
2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol has a molecular weight of 216.24 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrobenzo[h][1,4]benzodioxin-2-ylmethanol is sourced from PubChem (CID 13157038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).