About 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide
6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide (PubChem CID 131572289) has the molecular formula C8H7BrN2O3S
and a molecular weight of 291.13 g/mol. Its IUPAC name is 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide.
Molecular Properties
| Compound Name | 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide |
| PubChem CID | 131572289 |
| Molecular Formula | C8H7BrN2O3S |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc2ccc(CBr)cc2o1 |
| InChI | InChI=1S/C8H7BrN2O3S/c9-4-5-1-2-6-7(3-5)14-8(11-6)15(10,12)13/h1-3H,4H2,(H2,10,12,13) |
| InChIKey | VFPLXMULYVJRMU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide?
The IUPAC name of 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide (CID 131572289) is 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide.
What is the SMILES notation for 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide?
The canonical SMILES for 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide is NS(=O)(=O)c1nc2ccc(CBr)cc2o1.
What is the InChIKey of 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide?
The InChIKey is VFPLXMULYVJRMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O3S/c9-4-5-1-2-6-7(3-5)14-8(11-6)15(10,12)13/h1-3H,4H2,(H2,10,12,13).
What are the key properties of 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide?
6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide has a molecular weight of 291.13 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(bromomethyl)-1,3-benzoxazole-2-sulfonamide is sourced from PubChem (CID 131572289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).