About 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline
2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline (PubChem CID 13157282) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline.
Molecular Properties
| Compound Name | 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline |
| PubChem CID | 13157282 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline |
| SMILES | CCCCOC(C)c1cc2c(C)nc3ccccc3c2o1 |
| InChI | InChI=1S/C18H21NO2/c1-4-5-10-20-13(3)17-11-15-12(2)19-16-9-7-6-8-14(16)18(15)21-17/h6-9,11,13H,4-5,10H2,1-3H3 |
| InChIKey | NZCPWWWETUMEQM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline?
The IUPAC name of 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline (CID 13157282) is 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline.
What is the SMILES notation for 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline?
The canonical SMILES for 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline is CCCCOC(C)c1cc2c(C)nc3ccccc3c2o1.
What is the InChIKey of 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline?
The InChIKey is NZCPWWWETUMEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-4-5-10-20-13(3)17-11-15-12(2)19-16-9-7-6-8-14(16)18(15)21-17/h6-9,11,13H,4-5,10H2,1-3H3.
What are the key properties of 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline?
2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline has a molecular weight of 283.37 g/mol, XLogP of 5.17, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butoxyethyl)-4-methylfuro[3,2-c]quinoline is sourced from PubChem (CID 13157282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).