About (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one
(5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one (PubChem CID 13157338) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one |
| PubChem CID | 13157338 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one |
| SMILES | CC(c1ccccc1)N1C(=O)N(C)C(C)(C)/C1=N\O |
| InChI | InChI=1S/C14H19N3O2/c1-10(11-8-6-5-7-9-11)17-12(15-19)14(2,3)16(4)13(17)18/h5-10,19H,1-4H3/b15-12+ |
| InChIKey | NONOLEOYMGPFTL-NTCAYCPXSA-N |
| XLogP | 2.68 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one?
The IUPAC name of (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one (CID 13157338) is (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one.
What is the SMILES notation for (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one?
The canonical SMILES for (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one is CC(c1ccccc1)N1C(=O)N(C)C(C)(C)/C1=N\O.
What is the InChIKey of (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one?
The InChIKey is NONOLEOYMGPFTL-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-10(11-8-6-5-7-9-11)17-12(15-19)14(2,3)16(4)13(17)18/h5-10,19H,1-4H3/b15-12+.
What are the key properties of (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one?
(5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one has a molecular weight of 261.32 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-hydroxyimino-3,4,4-trimethyl-1-(1-phenylethyl)imidazolidin-2-one is sourced from PubChem (CID 13157338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).