C24H25N3O2S — CID 13157407
1-(2-phenylethylamino)-3-[4-(5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]propan-2-ol (PubChem CID 13157407) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-(2-phenylethylamino)-3-[4-(5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]propan-2-ol.
| Compound Name | 1-(2-phenylethylamino)-3-[4-(5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 13157407 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 1-(2-phenylethylamino)-3-[4-(5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]propan-2-ol |
| SMILES | OC(CNCCc1ccccc1)COc1ccc(-c2ncc(-c3cccs3)[nH]2)cc1 |
| InChI | InChI=1S/C24H25N3O2S/c28-20(15-25-13-12-18-5-2-1-3-6-18)17-29-21-10-8-19(9-11-21)24-26-16-22(27-24)23-7-4-14-30-23/h1-11,14,16,20,25,28H,12-13,15,17H2,(H,26,27) |
| InChIKey | BUVBCGDYVPTGMH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|