About (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid
(2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid (PubChem CID 131575081) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid |
| PubChem CID | 131575081 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid |
| SMILES | C[C@@H]1OCCO[C@@H]1C(=O)O |
| InChI | InChI=1S/C6H10O4/c1-4-5(6(7)8)10-3-2-9-4/h4-5H,2-3H2,1H3,(H,7,8)/t4-,5-/m0/s1 |
| InChIKey | ORABVXWUIHLPPW-WHFBIAKZSA-N |
| XLogP | -0.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid?
The IUPAC name of (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid (CID 131575081) is (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid.
What is the SMILES notation for (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid?
The canonical SMILES for (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid is C[C@@H]1OCCO[C@@H]1C(=O)O.
What is the InChIKey of (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid?
The InChIKey is ORABVXWUIHLPPW-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H10O4/c1-4-5(6(7)8)10-3-2-9-4/h4-5H,2-3H2,1H3,(H,7,8)/t4-,5-/m0/s1.
What are the key properties of (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid?
(2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid has a molecular weight of 146.14 g/mol, XLogP of -0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid is sourced from PubChem (CID 131575081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).