About 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine
5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine (PubChem CID 131575266) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine.
Analyze 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine?
The IUPAC name of 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine (CID 131575266) is 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine.
What is the SMILES notation for 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine?
The canonical SMILES for 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine is CC1COc2[nH]ncc2N1.
What is the InChIKey of 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine?
The InChIKey is WOKWVIYHPWFWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-4-3-10-6-5(8-4)2-7-9-6/h2,4,8H,3H2,1H3,(H,7,9).
What are the key properties of 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine?
5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine has a molecular weight of 139.16 g/mol, XLogP of 0.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,4,5,6-tetrahydropyrazolo[5,4-b][1,4]oxazine is sourced from PubChem (CID 131575266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).