C14H14N2O4 — CID 13157610
7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione (PubChem CID 13157610) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione.
| Compound Name | 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione |
|---|---|
| PubChem CID | 13157610 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione |
| SMILES | O=C1NC2(CCCO2)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C14H14N2O4/c17-11-12(18)16(9-10-5-2-1-3-6-10)13(19)14(15-11)7-4-8-20-14/h1-3,5-6H,4,7-9H2,(H,15,17) |
| InChIKey | UYUOEJPHGFNHNT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|